CAS 70478-63-6 appears in our catalog under these names: 4-Bromoisoindoline-1,3-dione, 96%, 4-Bromoisoindoline-1,3-dione 95%, 4-Bromoisoindoline-1,3-dione, 95%, 95%, 4-Bromoisoindole-1,3-dione, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
4-bromoisoindole-1,3-dione (CAS 70478-63-6) is a chemical compound with the molecular formula C8H4BrNO2 and a molecular weight of 226.03 g/mol. IUPAC name: 4-bromoisoindole-1,3-dione. InChIKey: ANENLORAJJKWAA-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO2 |
|---|---|
| Molecular weight | 226.03 g/mol |
| IUPAC name | 4-bromoisoindole-1,3-dione |
| InChIKey | ANENLORAJJKWAA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=O)NC2=O |
Computed by PubChem (NCBI)