Products 956387-03-4

CAS 956387-03-4 is the registry number for 3-(3-Methylphenyl)-1-phenyl-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

3-(3-methylphenyl)-1-phenylpyrazole-4-carboxylic acid (CAS 956387-03-4) is a chemical compound with the molecular formula C17H14N2O2 and a molecular weight of 278.30 g/mol. IUPAC name: 3-(3-methylphenyl)-1-phenylpyrazole-4-carboxylic acid. InChIKey: UNHBQSXNGUQFQF-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14N2O2
Molecular weight278.30 g/mol
IUPAC name3-(3-methylphenyl)-1-phenylpyrazole-4-carboxylic acid
InChIKeyUNHBQSXNGUQFQF-UHFFFAOYSA-N
SMILESCC1=CC(=CC=C1)C2=NN(C=C2C(=O)O)C3=CC=CC=C3

Computed by PubChem (NCBI)