Products 956985-41-4

CAS 956985-41-4 is the registry number for 1-Methyl-4-(1,2-oxazol-5-yl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1-methyl-4-(1,2-oxazol-5-yl)pyrazole-3-carboxylic acid (CAS 956985-41-4) is a chemical compound with the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. IUPAC name: 1-methyl-4-(1,2-oxazol-5-yl)pyrazole-3-carboxylic acid. InChIKey: NPLQXISDTNDUQP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7N3O3
Molecular weight193.16 g/mol
IUPAC name1-methyl-4-(1,2-oxazol-5-yl)pyrazole-3-carboxylic acid
InChIKeyNPLQXISDTNDUQP-UHFFFAOYSA-N
SMILESCN1C=C(C(=N1)C(=O)O)C2=CC=NO2

Computed by PubChem (NCBI)