CAS 956985-41-4 is the registry number for 1-Methyl-4-(1,2-oxazol-5-yl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-methyl-4-(1,2-oxazol-5-yl)pyrazole-3-carboxylic acid (CAS 956985-41-4) is a chemical compound with the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. IUPAC name: 1-methyl-4-(1,2-oxazol-5-yl)pyrazole-3-carboxylic acid. InChIKey: NPLQXISDTNDUQP-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O3 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 1-methyl-4-(1,2-oxazol-5-yl)pyrazole-3-carboxylic acid |
| InChIKey | NPLQXISDTNDUQP-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C(=O)O)C2=CC=NO2 |
Computed by PubChem (NCBI)