CAS 957312-81-1 is the registry number for 3-(1-Methyl-1H-pyrazol-4-yl)-isoxazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(1-methylpyrazol-4-yl)-1,2-oxazole-5-carboxylic acid (CAS 957312-81-1) is a chemical compound with the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. IUPAC name: 3-(1-methylpyrazol-4-yl)-1,2-oxazole-5-carboxylic acid. InChIKey: DDSMWOCNQXPFLN-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O3 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 3-(1-methylpyrazol-4-yl)-1,2-oxazole-5-carboxylic acid |
| InChIKey | DDSMWOCNQXPFLN-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=NOC(=C2)C(=O)O |
Computed by PubChem (NCBI)