Products 957312-81-1

CAS 957312-81-1 is the registry number for 3-(1-Methyl-1H-pyrazol-4-yl)-isoxazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-(1-methylpyrazol-4-yl)-1,2-oxazole-5-carboxylic acid (CAS 957312-81-1) is a chemical compound with the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. IUPAC name: 3-(1-methylpyrazol-4-yl)-1,2-oxazole-5-carboxylic acid. InChIKey: DDSMWOCNQXPFLN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7N3O3
Molecular weight193.16 g/mol
IUPAC name3-(1-methylpyrazol-4-yl)-1,2-oxazole-5-carboxylic acid
InChIKeyDDSMWOCNQXPFLN-UHFFFAOYSA-N
SMILESCN1C=C(C=N1)C2=NOC(=C2)C(=O)O

Computed by PubChem (NCBI)