CAS 958219-45-9 appears in our catalog under these names: 2–(2–(Thiophen–2–yl)phenyl)acetic acid, 2-(2-(Thiophen-2-yl)phenyl)acetic acid, 97%, 97%, 2-(2-(THIOPHEN-2-YL)PHENYL)ACETIC ACID, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(2-thiophen-2-ylphenyl)acetic acid (CAS 958219-45-9) is a chemical compound with the molecular formula C12H10O2S and a molecular weight of 218.27 g/mol. IUPAC name: 2-(2-thiophen-2-ylphenyl)acetic acid. InChIKey: JJJRVOAWTBMQAR-UHFFFAOYSA-N.
| Molecular formula | C12H10O2S |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | 2-(2-thiophen-2-ylphenyl)acetic acid |
| InChIKey | JJJRVOAWTBMQAR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)C2=CC=CS2 |
Computed by PubChem (NCBI)