CAS 95849-35-7 is the registry number for 5-(Benzo[d][1,3]dioxol-5-yl)-3,4-dihydro-2H-pyrrole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(1,3-benzodioxol-5-yl)-3,4-dihydro-2H-pyrrole (CAS 95849-35-7) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 5-(1,3-benzodioxol-5-yl)-3,4-dihydro-2H-pyrrole. InChIKey: RPRANYVNLYWRGO-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 5-(1,3-benzodioxol-5-yl)-3,4-dihydro-2H-pyrrole |
| InChIKey | RPRANYVNLYWRGO-UHFFFAOYSA-N |
| SMILES | C1CC(=NC1)C2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)