CAS 95901-15-8 appears in our catalog under these names: Methyl 6-mercapto-2-naphthoate, 98%, Methyl 6-sulfanylnaphthalene-2-carboxylate. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 50mg.
Methyl 6-sulfanylnaphthalene-2-carboxylate (CAS 95901-15-8) is a chemical compound with the molecular formula C12H10O2S and a molecular weight of 218.27 g/mol. IUPAC name: methyl 6-sulfanylnaphthalene-2-carboxylate. InChIKey: BNLGXHOJDCQIHZ-UHFFFAOYSA-N.
| Molecular formula | C12H10O2S |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | methyl 6-sulfanylnaphthalene-2-carboxylate |
| InChIKey | BNLGXHOJDCQIHZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C=C(C=C2)S |
Computed by PubChem (NCBI)