CAS 959140-89-7 appears in our catalog under these names: 1–(3–chlorophenyl)cyclobutan–1–amine hydrochloride, 1-(3-Chlorophenyl)cyclobutan-1-amine hydrochloride. Offered by: GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 0,5g, 50mg.
1-(3-chlorophenyl)cyclobutan-1-amine;hydrochloride (CAS 959140-89-7) is a chemical compound with the molecular formula C10H13Cl2N and a molecular weight of 218.12 g/mol. IUPAC name: 1-(3-chlorophenyl)cyclobutan-1-amine;hydrochloride. InChIKey: CHXWZDHUSNSLLQ-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N |
|---|---|
| Molecular weight | 218.12 g/mol |
| IUPAC name | 1-(3-chlorophenyl)cyclobutan-1-amine;hydrochloride |
| InChIKey | CHXWZDHUSNSLLQ-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC(=CC=C2)Cl)N.Cl |
Computed by PubChem (NCBI)