CAS 959236-67-0 appears in our catalog under these names: 5-(trifluoromethyl)-1H-indazole-3-carboxylic acid, 97%, 5-(trifluoromethyl)-1H-indazole-3-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g.
5-(trifluoromethyl)-1H-indazole-3-carboxylic acid (CAS 959236-67-0) is a chemical compound with the molecular formula C9H5F3N2O2 and a molecular weight of 230.14 g/mol. IUPAC name: 5-(trifluoromethyl)-1H-indazole-3-carboxylic acid. InChIKey: KEIWGKWVIMXMQT-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O2 |
|---|---|
| Molecular weight | 230.14 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1H-indazole-3-carboxylic acid |
| InChIKey | KEIWGKWVIMXMQT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)