CAS 959237-01-5 appears in our catalog under these names: 5–Bromoquinazoline–2,4(1H,3H)–dione, 5-Bromoquinazoline-2,4(1h,3h)-dione, 98%, 5-Bromoquinazoline-2,4(1H,3H)-dione, 97%, 5-Bromoquinazoline-2,4(1H,3H)-dione, 97%, 97%. Offered by: GLPBio, Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 5g, 1g.
5-bromo-1H-quinazoline-2,4-dione (CAS 959237-01-5) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 5-bromo-1H-quinazoline-2,4-dione. InChIKey: XVGJXAHPJRPIOH-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 5-bromo-1H-quinazoline-2,4-dione |
| InChIKey | XVGJXAHPJRPIOH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)