CAS 959237-42-4 is the registry number for 6-Methoxy-2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
6-methoxy-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid (CAS 959237-42-4) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 6-methoxy-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid. InChIKey: CSXKQOMETSMOEJ-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 6-methoxy-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid |
| InChIKey | CSXKQOMETSMOEJ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=O)CC2C(=O)O |
Computed by PubChem (NCBI)