Products 95932-39-1
CAS 95932-39-1 is the registry number for 4-Aminophenyl tert-butyl carbonate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
(4-aminophenyl) tert-butyl carbonate (CAS 95932-39-1) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: (4-aminophenyl) tert-butyl carbonate. InChIKey: CDNPVHFIIFBSNH-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | (4-aminophenyl) tert-butyl carbonate |
| InChIKey | CDNPVHFIIFBSNH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)OC1=CC=C(C=C1)N |
Computed by PubChem (NCBI)