Products 959750-74-4
CAS 959750-74-4 appears in our catalog under these names: tert-Butyl (R)-2-aminobutanoate hydrochloride, 98%, 98%, tert-Butyl (R)-2-aminobutanoate hydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g.
Tert-butyl (2R)-2-aminobutanoate;hydrochloride (CAS 959750-74-4) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: tert-butyl (2R)-2-aminobutanoate;hydrochloride. InChIKey: OEPKETQBSXWOBJ-FYZOBXCZSA-N.
| Molecular formula | C8H18ClNO2 |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | tert-butyl (2R)-2-aminobutanoate;hydrochloride |
| InChIKey | OEPKETQBSXWOBJ-FYZOBXCZSA-N |
| SMILES | CC[C@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
tert-butyl (2R)-2-aminobutanoate hydrochloride, H-D-Abu-Otbu HCl, tert-Butyl (R)-2-aminobutanoate hydrochloride, D-2-Aminobutyric acid tert-butyl ester hydrochloride, tert-butyl (2R)-2-aminobutanoate;hydrochloride, H-D-Abu-OtBu . HCl, D-Abu-OtBu.HCl, H-D-Abu-OtBu hydrochloride, D-alpha-Aminobutyric acid t-butyl ester hydrochloride, OEPKETQBSXWOBJ-FYZOBXCZSA-N