Products 959786-80-2
CAS 959786-80-2 is the registry number for alpha-Naphthyl-d7 Glycidyl Ether. Offered by: TRC. Available pack sizes: 25mg.
2-[(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)oxymethyl]oxirane (CAS 959786-80-2) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 207.28 g/mol. IUPAC name: 2-[(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)oxymethyl]oxirane. InChIKey: QYYCPWLLBSSFBW-GSNKEKJESA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 207.28 g/mol |
| IUPAC name | 2-[(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)oxymethyl]oxirane |
| InChIKey | QYYCPWLLBSSFBW-GSNKEKJESA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=C2OCC3CO3)[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)