CAS 61249-00-1 appears in our catalog under these names: S-(+)-Alpha-Naphthyl Glycidyl Ether, >95% (HPLC), S-(+)-a-Naphthyl Glycidyl Ether, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.
(2S)-2-(naphthalen-1-yloxymethyl)oxirane (CAS 61249-00-1) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: (2S)-2-(naphthalen-1-yloxymethyl)oxirane. InChIKey: QYYCPWLLBSSFBW-NSHDSACASA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | (2S)-2-(naphthalen-1-yloxymethyl)oxirane |
| InChIKey | QYYCPWLLBSSFBW-NSHDSACASA-N |
| SMILES | C1[C@H](O1)COC2=CC=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)