Products 960-24-7

CAS 960-24-7 is the registry number for 1-Methylcyclohexylphthalic Acid Ester. Offered by: TRC. Available pack sizes: 500mg.

Structural formula: {0} (CAS {1})

2-(1-methylcyclohexyl)oxycarbonylbenzoic acid (CAS 960-24-7) is a chemical compound with the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. IUPAC name: 2-(1-methylcyclohexyl)oxycarbonylbenzoic acid. InChIKey: GONWOZUQGIDGER-UHFFFAOYSA-N.

Identity
Molecular formulaC15H18O4
Molecular weight262.30 g/mol
IUPAC name2-(1-methylcyclohexyl)oxycarbonylbenzoic acid
InChIKeyGONWOZUQGIDGER-UHFFFAOYSA-N
SMILESCC1(CCCCC1)OC(=O)C2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)