Products 960119-75-9
CAS 960119-75-9 is the registry number for Fc 11a-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-ethyl-5-methyl-2-phenylbenzimidazole (CAS 960119-75-9) is a chemical compound with the molecular formula C16H16N2 and a molecular weight of 236.31 g/mol. IUPAC name: 1-ethyl-5-methyl-2-phenylbenzimidazole. InChIKey: LAPXJMHYUYXOQN-UHFFFAOYSA-N.
| Molecular formula | C16H16N2 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | 1-ethyl-5-methyl-2-phenylbenzimidazole |
| InChIKey | LAPXJMHYUYXOQN-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)C)N=C1C3=CC=CC=C3 |
Computed by PubChem (NCBI)