CAS 960535-40-4 is the registry number for 2–Chloromethyl–6–methylbenzothiazole. Offered by: GLPBio. Available pack sizes: 250mg, 50mg.
2-chloro-6,7-difluoro-1,3-benzothiazole (CAS 960535-40-4) is a chemical compound with the molecular formula C7H2ClF2NS and a molecular weight of 205.61 g/mol. IUPAC name: 2-chloro-6,7-difluoro-1,3-benzothiazole. InChIKey: HDJYDESOUSSSGF-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF2NS |
|---|---|
| Molecular weight | 205.61 g/mol |
| IUPAC name | 2-chloro-6,7-difluoro-1,3-benzothiazole |
| InChIKey | HDJYDESOUSSSGF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1N=C(S2)Cl)F)F |
Computed by PubChem (NCBI)