CAS 96296-39-8 appears in our catalog under these names: 2-Butyl-1,3-dioxo-2,3-dihydro-1h-isoindole-5-carboxylic acid, 95%, 2-Butyl-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 0,5g.
2-butyl-1,3-dioxoisoindole-5-carboxylic acid (CAS 96296-39-8) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: 2-butyl-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: JPWIWDRTZPWZIL-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 2-butyl-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | JPWIWDRTZPWZIL-UHFFFAOYSA-N |
| SMILES | CCCCN1C(=O)C2=C(C1=O)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)