CAS 96346-81-5 is the registry number for 3–AMINO–2,3–DIHYDRO–1,5–BENZOTHIAZEPIN–4(5H)–ONE. Offered by: GLPBio. Available pack sizes: 200mg.
3-amino-3,5-dihydro-2H-1,5-benzothiazepin-4-one (CAS 96346-81-5) is a chemical compound with the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. IUPAC name: 3-amino-3,5-dihydro-2H-1,5-benzothiazepin-4-one. InChIKey: CVTKHBONQJBXKR-UHFFFAOYSA-N.
| Molecular formula | C9H10N2OS |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | 3-amino-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
| InChIKey | CVTKHBONQJBXKR-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)NC2=CC=CC=C2S1)N |
Computed by PubChem (NCBI)