Products 96356-05-7
CAS 96356-05-7 is the registry number for Ethyl 2-methylimidazo[2,1-b]-1,3,4-thiadiazole-6-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-methylimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylate (CAS 96356-05-7) is a chemical compound with the molecular formula C8H9N3O2S and a molecular weight of 211.24 g/mol. IUPAC name: ethyl 2-methylimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylate. InChIKey: LUYVCFGUZCWYAK-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O2S |
|---|---|
| Molecular weight | 211.24 g/mol |
| IUPAC name | ethyl 2-methylimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylate |
| InChIKey | LUYVCFGUZCWYAK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN2C(=N1)SC(=N2)C |
Computed by PubChem (NCBI)