Products 96447-10-8

CAS 96447-10-8 is the registry number for Spiro[benzo[d][1,3]oxazine-2,1'-cyclohexan]-4(1H)-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Spiro[1H-3,1-benzoxazine-2,1'-cyclohexane]-4-one (CAS 96447-10-8) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: spiro[1H-3,1-benzoxazine-2,1'-cyclohexane]-4-one. InChIKey: SCPRRVZEKLKYKQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO2
Molecular weight217.26 g/mol
IUPAC namespiro[1H-3,1-benzoxazine-2,1'-cyclohexane]-4-one
InChIKeySCPRRVZEKLKYKQ-UHFFFAOYSA-N
SMILESC1CCC2(CC1)NC3=CC=CC=C3C(=O)O2

Computed by PubChem (NCBI)