CAS 96498-79-2 appears in our catalog under these names: 3-Amino-6-bromoquinazolin-4(3H)-one, 98%, 3-Amino-6-bromo-3,4-dihydroquinazolin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 2,5g, 250mg.
3-amino-6-bromoquinazolin-4-one (CAS 96498-79-2) is a chemical compound with the molecular formula C8H6BrN3O and a molecular weight of 240.06 g/mol. IUPAC name: 3-amino-6-bromoquinazolin-4-one. InChIKey: KAUIMEGESZUAKR-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3O |
|---|---|
| Molecular weight | 240.06 g/mol |
| IUPAC name | 3-amino-6-bromoquinazolin-4-one |
| InChIKey | KAUIMEGESZUAKR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=O)N(C=N2)N |
Computed by PubChem (NCBI)