Products 97914-54-0
CAS 97914-54-0 appears in our catalog under these names: Methyl 4-(Difluoromethoxy)benzoate, 95%, 4-Difluoromethoxy-benzoic acid methyl ester, Methyl 4-(difluoromethoxy)benzoate, 95%, 95%, 4-Difluoromethoxy-benzoic acid methyl ester, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 2,5g, 1g, 5g, 250mg, 500mg, 2.5g, 10g.
Methyl 4-(difluoromethoxy)benzoate (CAS 97914-54-0) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: methyl 4-(difluoromethoxy)benzoate. InChIKey: VAAWCCULYWEXPM-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O3 |
|---|---|
| Molecular weight | 202.15 g/mol |
| IUPAC name | methyl 4-(difluoromethoxy)benzoate |
| InChIKey | VAAWCCULYWEXPM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)OC(F)F |
Computed by PubChem (NCBI)