CAS 97945-38-5 is the registry number for Tetrahydro-2-(2-nitropropoxy)-2H-pyran. Offered by: TRC. Available pack sizes: 2,5g, 250mg.
2-(2-nitropropoxy)oxane (CAS 97945-38-5) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: 2-(2-nitropropoxy)oxane. InChIKey: BFEGMSZCHMIMNA-UHFFFAOYSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 2-(2-nitropropoxy)oxane |
| InChIKey | BFEGMSZCHMIMNA-UHFFFAOYSA-N |
| SMILES | CC(COC1CCCCO1)[N+](=O)[O-] |
Computed by PubChem (NCBI)