Products 98238-08-5
CAS 98238-08-5 is the registry number for 2-(Pyridine-3-carbonyl)cyclopentan-1-one, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(pyridine-3-carbonyl)cyclopentan-1-one (CAS 98238-08-5) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 2-(pyridine-3-carbonyl)cyclopentan-1-one. InChIKey: DOYIYVYKJSUOOI-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 2-(pyridine-3-carbonyl)cyclopentan-1-one |
| InChIKey | DOYIYVYKJSUOOI-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)C1)C(=O)C2=CN=CC=C2 |
Computed by PubChem (NCBI)