CAS 98299-14-0 appears in our catalog under these names: 5-Chloro-2-methoxybenzene-1,3-dicarbaldehyde, 95%, 5-Chloro-2-methoxybenzene-1,3-dicarbaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-chloro-2-methoxybenzene-1,3-dicarbaldehyde (CAS 98299-14-0) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: 5-chloro-2-methoxybenzene-1,3-dicarbaldehyde. InChIKey: UQMOUTHOQIWVGE-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO3 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 5-chloro-2-methoxybenzene-1,3-dicarbaldehyde |
| InChIKey | UQMOUTHOQIWVGE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1C=O)Cl)C=O |
Computed by PubChem (NCBI)