CAS 98326-78-4 is the registry number for N-Butyl-3-nitroaniline, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-butyl-3-nitroaniline (CAS 98326-78-4) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: N-butyl-3-nitroaniline. InChIKey: ZVSJFPOKRSIYSH-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | N-butyl-3-nitroaniline |
| InChIKey | ZVSJFPOKRSIYSH-UHFFFAOYSA-N |
| SMILES | CCCCNC1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)