CAS 98477-12-4 is the registry number for Ethyl 1-(tert-butyl)-5-cyano-1H-pyrazole-4-carboxylate. Offered by: Chemat. Available pack sizes: 1g.
Ethyl 1-tert-butyl-5-cyanopyrazole-4-carboxylate (CAS 98477-12-4) is a chemical compound with the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. IUPAC name: ethyl 1-tert-butyl-5-cyanopyrazole-4-carboxylate. InChIKey: LAGPFWNCTYDVGM-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O2 |
|---|---|
| Molecular weight | 221.26 g/mol |
| IUPAC name | ethyl 1-tert-butyl-5-cyanopyrazole-4-carboxylate |
| InChIKey | LAGPFWNCTYDVGM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C(C)(C)C)C#N |
Computed by PubChem (NCBI)