Products 98496-30-1
CAS 98496-30-1 appears in our catalog under these names: Isoproterenol Impurity 4, Isoprenaline Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
1-propan-2-yl-2,3-dihydroindole-3,5,6-triol (CAS 98496-30-1) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: 1-propan-2-yl-2,3-dihydroindole-3,5,6-triol. InChIKey: BEIUVJDBUQYVOV-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 1-propan-2-yl-2,3-dihydroindole-3,5,6-triol |
| InChIKey | BEIUVJDBUQYVOV-UHFFFAOYSA-N |
| SMILES | CC(C)N1CC(C2=CC(=C(C=C21)O)O)O |
Computed by PubChem (NCBI)