CAS 98510-52-2 appears in our catalog under these names: 3-(Phenylsulfonyl)propan-1-amine, 95%, 3-(Benzenesulfonyl)propan-1-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
3-(benzenesulfonyl)propan-1-amine (CAS 98510-52-2) is a chemical compound with the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. IUPAC name: 3-(benzenesulfonyl)propan-1-amine. InChIKey: GHNFGRIDWGVTNH-UHFFFAOYSA-N.
| Molecular formula | C9H13NO2S |
|---|---|
| Molecular weight | 199.27 g/mol |
| IUPAC name | 3-(benzenesulfonyl)propan-1-amine |
| InChIKey | GHNFGRIDWGVTNH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CCCN |
Computed by PubChem (NCBI)