CAS 98516-73-5 appears in our catalog under these names: H-Ser-AMC, H–Ser–AMC, H-Ser-AMC hydrochloride salt. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 500mg.
2-amino-3-hydroxy-N-(4-methyl-2-oxochromen-7-yl)propanamide (CAS 98516-73-5) is a chemical compound with the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. IUPAC name: 2-amino-3-hydroxy-N-(4-methyl-2-oxochromen-7-yl)propanamide. InChIKey: QAFWDHVUVKEUMK-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O4 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 2-amino-3-hydroxy-N-(4-methyl-2-oxochromen-7-yl)propanamide |
| InChIKey | QAFWDHVUVKEUMK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)C(CO)N |
Computed by PubChem (NCBI)