CAS 98708-80-6 appears in our catalog under these names: 2–Amino–3–(4–(tert–butyl)phenyl)propanoic acid, 2-Amino-3-(4-(tert-butyl)phenyl)propanoic acid, 95%, 95%, 2-Amino-3-(4-(tert-butyl)phenyl)propanoic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
2-amino-3-(4-tert-butylphenyl)propanoic acid (CAS 98708-80-6) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: 2-amino-3-(4-tert-butylphenyl)propanoic acid. InChIKey: CSJZKSXYLTYFPU-UHFFFAOYSA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | 2-amino-3-(4-tert-butylphenyl)propanoic acid |
| InChIKey | CSJZKSXYLTYFPU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CC(C(=O)O)N |
Computed by PubChem (NCBI)