CAS 98935-61-6 appears in our catalog under these names: 2-(1-Methyl-1H-indol-5-yl)acetic acid, 98%, 98%, 2-(1-Methyl-1H-indol-5-yl)acetic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg.
2-(1-methylindol-5-yl)acetic acid (CAS 98935-61-6) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 2-(1-methylindol-5-yl)acetic acid. InChIKey: LRNLMHUUAAXAHE-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 2-(1-methylindol-5-yl)acetic acid |
| InChIKey | LRNLMHUUAAXAHE-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=C1C=CC(=C2)CC(=O)O |
Computed by PubChem (NCBI)