CAS 98935-65-0 appears in our catalog under these names: Dimethyl (2s,4r)-piperidine-2,4-dicarboxylate, 90%, cis-Dimethyl piperidine-2,4-dicarboxylate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
Dimethyl (2S,4R)-piperidine-2,4-dicarboxylate (CAS 98935-65-0) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: dimethyl (2S,4R)-piperidine-2,4-dicarboxylate. InChIKey: GDJHLIFSMMYQEN-RQJHMYQMSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | dimethyl (2S,4R)-piperidine-2,4-dicarboxylate |
| InChIKey | GDJHLIFSMMYQEN-RQJHMYQMSA-N |
| SMILES | COC(=O)[C@@H]1CCN[C@@H](C1)C(=O)OC |
Computed by PubChem (NCBI)