CAS 99009-93-5 appears in our catalog under these names: 3-Nitro-N-phenylquinolin-4-amine, 95%, N–BENZYL–3–NITROQUINOLIN–4–AMINE. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
N-benzyl-3-nitroquinolin-4-amine (CAS 99009-93-5) is a chemical compound with the molecular formula C16H13N3O2 and a molecular weight of 279.29 g/mol. IUPAC name: N-benzyl-3-nitroquinolin-4-amine. InChIKey: LOOLNLMGAXKIJT-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O2 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | N-benzyl-3-nitroquinolin-4-amine |
| InChIKey | LOOLNLMGAXKIJT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=C(C=NC3=CC=CC=C32)[N+](=O)[O-] |
Computed by PubChem (NCBI)