CAS 99070-17-4 appears in our catalog under these names: 3-Bromo-4-isopropylbenzoic acid, 3–Bromo–4–isopropylbenzoic acid, 3-Bromo-4-isopropylbenzoic acid 96%, 3-Bromo-4-isopropylbenzoic acid, 97%, 3-Bromo-4-isopropylbenzoic acid, 96%, 96%. Offered by: TRC, GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
3-bromo-4-propan-2-ylbenzoic acid (CAS 99070-17-4) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 3-bromo-4-propan-2-ylbenzoic acid. InChIKey: VLOPEDMMJXCNSH-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 3-bromo-4-propan-2-ylbenzoic acid |
| InChIKey | VLOPEDMMJXCNSH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=C(C=C1)C(=O)O)Br |
Computed by PubChem (NCBI)