Products 99070-18-5
CAS 99070-18-5 appears in our catalog under these names: 2–(4–Bromophenyl)butanoic acid, 2-(4-Bromophenyl)butanoic acid, 2-(4-Bromophenyl)butanoic acid 97%, 2-(4-Bromophenyl)butanoic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 25g.
2-(4-bromophenyl)butanoic acid (CAS 99070-18-5) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 2-(4-bromophenyl)butanoic acid. InChIKey: XVEFRABIRRNWFO-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 2-(4-bromophenyl)butanoic acid |
| InChIKey | XVEFRABIRRNWFO-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(4-bromophenyl)butanoic acid, 2-(4-Bromophenyl)butyric acid, 4-Bromo-|A-ethyl-benzeneacetic acid, 2-(p-Bromophenyl)butyric acid, (4-Bromophenyl)(ethyl)acetic acid, BUTYRIC ACID, 2-(p-BROMOPHENYL)-, 4-bromophenylbutanoic acid, 4-bromophenyl butyric acid, 3-09-00-02469 (Beilstein Handbook Reference), 2-(4-bromophenyl)butanoicacid