CAS 99070-20-9 is the registry number for 3-Bromo-6-hydroxy-2,4,5-trimethylbenzaldehyde 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-2-hydroxy-3,4,6-trimethylbenzaldehyde (CAS 99070-20-9) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 5-bromo-2-hydroxy-3,4,6-trimethylbenzaldehyde. InChIKey: PIJUDIPVGVUVGY-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 5-bromo-2-hydroxy-3,4,6-trimethylbenzaldehyde |
| InChIKey | PIJUDIPVGVUVGY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1O)C=O)C)Br)C |
Computed by PubChem (NCBI)