CAS 99295-78-0 appears in our catalog under these names: (R)–2–Amino–3–(3–bromophenyl)propanoic acid, H-D-Phe(3-Br)-OH, 95%, 95%, (R)-2-Amino-3-(3-bromophenyl)propanoic acid, 99.79%, (R)-2-Amino-3-(3-bromophenyl)propanoic acid, 95%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 500mg, 100mg, 250mg, 5g, 10g, 25g, 100g.
(2R)-2-amino-3-(3-bromophenyl)propanoic acid (CAS 99295-78-0) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: (2R)-2-amino-3-(3-bromophenyl)propanoic acid. InChIKey: GDMOHOYNMWWBAU-MRVPVSSYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | (2R)-2-amino-3-(3-bromophenyl)propanoic acid |
| InChIKey | GDMOHOYNMWWBAU-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)