CAS 30163-20-3 appears in our catalog under these names: 2-Amino-3-(3-bromophenyl)propanoic acid, 95%, DL-3-Bromophenylalanine, 2-amino-3-(3-bromophenyl)propanoic acid, 98%, 98%, 3–Bromo–DL–phenylalanine, 3-Bromo-DL-phenylalanine, 99.93%. Offered by: Fluorochem, TRC, Chemat, GLPBio, MedChemExpress. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 100mg, 100 g.
2-amino-3-(3-bromophenyl)propanoic acid (CAS 30163-20-3) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: 2-amino-3-(3-bromophenyl)propanoic acid. InChIKey: GDMOHOYNMWWBAU-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | 2-amino-3-(3-bromophenyl)propanoic acid |
| InChIKey | GDMOHOYNMWWBAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)CC(C(=O)O)N |
Computed by PubChem (NCBI)