CAS 99465-10-8 appears in our catalog under these names: 7–bromoquinolin–2(1H)–one, 7-Bromoquinolin-2(1H)-one 98%, 7-Bromoquinolin-2(1H)-one, 98%, 98%, 7-Bromoquinolin-2(1H)-one, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 25g, 2.5g, 10g.
7-bromo-1H-quinolin-2-one (CAS 99465-10-8) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 7-bromo-1H-quinolin-2-one. InChIKey: QOFKBVYWLUKWLL-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 7-bromo-1H-quinolin-2-one |
| InChIKey | QOFKBVYWLUKWLL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=O)N2)Br |
Computed by PubChem (NCBI)