CAS 99532-52-2 appears in our catalog under these names: 1-(6-methoxy-1H-indol-3-yl)ethanone, 95+%, 95+%, 3-Acetyl-6-methoxyindole, 95+%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
1-(6-methoxy-1H-indol-3-yl)ethanone (CAS 99532-52-2) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 1-(6-methoxy-1H-indol-3-yl)ethanone. InChIKey: GAIXPKAQNPGEGP-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 1-(6-methoxy-1H-indol-3-yl)ethanone |
| InChIKey | GAIXPKAQNPGEGP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CNC2=C1C=CC(=C2)OC |
Computed by PubChem (NCBI)