CAS 99585-16-7 appears in our catalog under these names: 3-((2-Chlorophenyl)thio)propanoic acid, 97%, 3-((2-Chlorophenyl)sulfanyl)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 250mg, 2,5g.
3-(2-chlorophenyl)sulfanylpropanoic acid (CAS 99585-16-7) is a chemical compound with the molecular formula C9H9ClO2S and a molecular weight of 216.68 g/mol. IUPAC name: 3-(2-chlorophenyl)sulfanylpropanoic acid. InChIKey: NYUNDDKGPQCWPL-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2S |
|---|---|
| Molecular weight | 216.68 g/mol |
| IUPAC name | 3-(2-chlorophenyl)sulfanylpropanoic acid |
| InChIKey | NYUNDDKGPQCWPL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)SCCC(=O)O)Cl |
Computed by PubChem (NCBI)