CAS 99853-21-1 appears in our catalog under these names: 6-Bromo-2,3-dihydro-2,2-dimethylchromen-4-one, 6-Bromo-2,2-dimethylchroman-4-one 98%, 6-Bromo-2,2-dimethylchroman-4-one, 98%, 98%, 6-Bromo-2,2-dimethyl-4-chromanone, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 0,25g, 2,5g, 250mg, 1g, 5g, 10g, 25g, 100g.
6-bromo-2,2-dimethyl-3H-chromen-4-one (CAS 99853-21-1) is a chemical compound with the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. IUPAC name: 6-bromo-2,2-dimethyl-3H-chromen-4-one. InChIKey: KMLKUNVLSWKFLA-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO2 |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | 6-bromo-2,2-dimethyl-3H-chromen-4-one |
| InChIKey | KMLKUNVLSWKFLA-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C(O1)C=CC(=C2)Br)C |
Computed by PubChem (NCBI)