cas: 1085333-97-6 — see every product listed under this CAS number, including other names
rac NorMetanephrine-d3 Hydrochloride (CAS 1085333-97-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg. Offered by: TargetMol.
| brand | TargetMol |
|---|---|
| catalog number | TMIH-0474-1mg |
| cas | 1085333-97-6 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 2019.55 Pln | |
| TargetMol | 5mg | 5160.57 Pln | |
| TargetMol | 10mg | 6947.13 Pln | |
| TargetMol | 25mg | 10168.09 Pln |
| purity | No data |
|---|---|
| delivery time | approx. 33 days |
4-(2-amino-1,2,2-trideuterio-1-hydroxyethyl)-2-methoxyphenol;hydrochloride (CAS 1085333-97-6) is a chemical compound with the molecular formula C9H14ClNO3 and a molecular weight of 222.68 g/mol. IUPAC name: 4-(2-amino-1,2,2-trideuterio-1-hydroxyethyl)-2-methoxyphenol;hydrochloride. InChIKey: VKFPRGQZWKTEON-IJJJTAPTSA-N.
| Molecular formula | C9H14ClNO3 |
|---|---|
| Molecular weight | 222.68 g/mol |
| IUPAC name | 4-(2-amino-1,2,2-trideuterio-1-hydroxyethyl)-2-methoxyphenol;hydrochloride |
| InChIKey | VKFPRGQZWKTEON-IJJJTAPTSA-N |
| SMILES | [2H]C([2H])(C([2H])(C1=CC(=C(C=C1)O)OC)O)N.Cl |
Computed by PubChem (NCBI)