CAS 1085333-97-6 appears in our catalog under these names: Normetanephrine-d3 HCl, rac Normetanephrine-d3 Hydrochloride, >95% (HPLC), (±)-Normetanephrine-alpha,beta,beta-d3 HCl, 98 atom % D, min 98% Chemical Purity, rac NorMetanephrine-d3 Hydrochloride, Normetanephrine–d3 hydrochloride. Offered by: Chemat Brand, TRC, CDN, TargetMol, GLPBio. Available pack sizes: on request, 10mg, 1mg, 0,01g, 0,005g, 5mg, 25mg, 1x1ml.
4-(2-amino-1,2,2-trideuterio-1-hydroxyethyl)-2-methoxyphenol;hydrochloride (CAS 1085333-97-6) is a chemical compound with the molecular formula C9H14ClNO3 and a molecular weight of 222.68 g/mol. IUPAC name: 4-(2-amino-1,2,2-trideuterio-1-hydroxyethyl)-2-methoxyphenol;hydrochloride. InChIKey: VKFPRGQZWKTEON-IJJJTAPTSA-N.
| Molecular formula | C9H14ClNO3 |
|---|---|
| Molecular weight | 222.68 g/mol |
| IUPAC name | 4-(2-amino-1,2,2-trideuterio-1-hydroxyethyl)-2-methoxyphenol;hydrochloride |
| InChIKey | VKFPRGQZWKTEON-IJJJTAPTSA-N |
| SMILES | [2H]C([2H])(C([2H])(C1=CC(=C(C=C1)O)OC)O)N.Cl |
Computed by PubChem (NCBI)