sec-Butyl 2-acetoxybenzoate, 95%
cas: 899442-48-9 — see every product listed under this CAS number, including other names
sec-Butyl 2-acetoxybenzoate, 95% (CAS 899442-48-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1722648-100mg |
| cas | 899442-48-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 670.75 Pln | |
| Ambeed | 250mg | 1288.19 Pln | |
| Ambeed | 1g | 3769.06 Pln | |
| BLDpharm | 100mg | 658.68 Pln | |
| BLDpharm | 250mg | 1269.58 Pln | |
| BLDpharm | 1g | 3696.50 Pln | |
| Chemat | 100mg | 587.60 Pln | |
| Chemat | 250mg | 1110.80 Pln | |
| Chemat | 1g | 3208.40 Pln | |
| Fluorochem | 100mg | 1080.89 Pln | |
| Fluorochem | 250mg | 2054.50 Pln | |
| Fluorochem | 1g | 5954.17 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Butan-2-yl 2-acetyloxybenzoate (CAS 899442-48-9) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: butan-2-yl 2-acetyloxybenzoate. InChIKey: QLJDWMXPVRBDTH-UHFFFAOYSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | butan-2-yl 2-acetyloxybenzoate |
| InChIKey | QLJDWMXPVRBDTH-UHFFFAOYSA-N |
| SMILES | CCC(C)OC(=O)C1=CC=CC=C1OC(=O)C |
Computed by PubChem (NCBI)