cas: 142570-56-7 — see every product listed under this CAS number, including other names
tert-Butyl (3-(methoxy(methyl)amino)-3-oxopropyl)carbamate 95% (CAS 142570-56-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A890001-250mg |
| cas | 142570-56-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1010.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A890001 |
Tert-butyl N-[3-[methoxy(methyl)amino]-3-oxopropyl]carbamate (CAS 142570-56-7) is a chemical compound with the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. IUPAC name: tert-butyl N-[3-[methoxy(methyl)amino]-3-oxopropyl]carbamate. InChIKey: SFDSZSRXXGFFEH-UHFFFAOYSA-N.
| Molecular formula | C10H20N2O4 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | tert-butyl N-[3-[methoxy(methyl)amino]-3-oxopropyl]carbamate |
| InChIKey | SFDSZSRXXGFFEH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)N(C)OC |
Computed by PubChem (NCBI)