cas: 1086378-71-3 — see every product listed under this CAS number, including other names
tert-Butyl (3-hydroxy-2,3-dihydro-1H-inden-1-yl)carbamate 95% (CAS 1086378-71-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A310982-50mg |
| cas | 1086378-71-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 437.12 Pln | |
| Ambeed | 100mg | 681.88 Pln | |
| Ambeed | 250mg | 987.81 Pln | |
| Ambeed | 1g | 2356.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A310982 |
Tert-butyl N-(3-hydroxy-2,3-dihydro-1H-inden-1-yl)carbamate (CAS 1086378-71-3) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 249.30 g/mol. IUPAC name: tert-butyl N-(3-hydroxy-2,3-dihydro-1H-inden-1-yl)carbamate. InChIKey: REHNRWSWBXHXSB-UHFFFAOYSA-N.
| Molecular formula | C14H19NO3 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | tert-butyl N-(3-hydroxy-2,3-dihydro-1H-inden-1-yl)carbamate |
| InChIKey | REHNRWSWBXHXSB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CC(C2=CC=CC=C12)O |
Computed by PubChem (NCBI)